C22H23N3O6 — CID 177047514
N-[4-(3-ethoxypropylcarbamoyl)-2-(furan-2-carbonylamino)phenyl]furan-2-carboxamide (PubChem CID 177047514) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is N-[4-(3-ethoxypropylcarbamoyl)-2-(furan-2-carbonylamino)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-(3-ethoxypropylcarbamoyl)-2-(furan-2-carbonylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 177047514 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[4-(3-ethoxypropylcarbamoyl)-2-(furan-2-carbonylamino)phenyl]furan-2-carboxamide |
| SMILES | CCOCCCNC(=O)c1ccc(NC(=O)c2ccco2)c(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C22H23N3O6/c1-2-29-11-5-10-23-20(26)15-8-9-16(24-21(27)18-6-3-12-30-18)17(14-15)25-22(28)19-7-4-13-31-19/h3-4,6-9,12-14H,2,5,10-11H2,1H3,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | DHBBMKSFMYOYMK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 122.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|