C18H22N2O5 — CID 9476382
N'-[3-ethoxy-4-(2-methylpropoxy)benzoyl]furan-2-carbohydrazide (PubChem CID 9476382) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is N'-[3-ethoxy-4-(2-methylpropoxy)benzoyl]furan-2-carbohydrazide.
| Compound Name | N'-[3-ethoxy-4-(2-methylpropoxy)benzoyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 9476382 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N'-[3-ethoxy-4-(2-methylpropoxy)benzoyl]furan-2-carbohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2ccco2)ccc1OCC(C)C |
| InChI | InChI=1S/C18H22N2O5/c1-4-23-16-10-13(7-8-14(16)25-11-12(2)3)17(21)19-20-18(22)15-6-5-9-24-15/h5-10,12H,4,11H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | KYDFSBZIAMLKOK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|