C21H18FN3O5 — CID 4795361
N-[5-[[[2-(4-fluorophenoxy)acetyl]amino]carbamoyl]-2-methylphenyl]furan-2-carboxamide (PubChem CID 4795361) has the molecular formula C21H18FN3O5 and a molecular weight of 411.39 g/mol. Its IUPAC name is N-[5-[[[2-(4-fluorophenoxy)acetyl]amino]carbamoyl]-2-methylphenyl]furan-2-carboxamide.
| Compound Name | N-[5-[[[2-(4-fluorophenoxy)acetyl]amino]carbamoyl]-2-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4795361 |
| Molecular Formula | C21H18FN3O5 |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-[5-[[[2-(4-fluorophenoxy)acetyl]amino]carbamoyl]-2-methylphenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NNC(=O)COc2ccc(F)cc2)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C21H18FN3O5/c1-13-4-5-14(11-17(13)23-21(28)18-3-2-10-29-18)20(27)25-24-19(26)12-30-16-8-6-15(22)7-9-16/h2-11H,12H2,1H3,(H,23,28)(H,24,26)(H,25,27) |
| InChIKey | MXNVLRAOPCAFDM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|