C25H20FN3O5S — CID 4875172
N-[5-[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]-2-methylphenyl]furan-2-carboxamide (PubChem CID 4875172) has the molecular formula C25H20FN3O5S and a molecular weight of 493.52 g/mol. Its IUPAC name is N-[5-[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]-2-methylphenyl]furan-2-carboxamide.
| Compound Name | N-[5-[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]-2-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4875172 |
| Molecular Formula | C25H20FN3O5S |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | N-[5-[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]-2-methylphenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCN2C(=O)SC(=Cc3ccc(F)cc3)C2=O)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C25H20FN3O5S/c1-15-4-7-17(14-19(15)28-23(31)20-3-2-12-34-20)22(30)27-10-11-29-24(32)21(35-25(29)33)13-16-5-8-18(26)9-6-16/h2-9,12-14H,10-11H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | VMDURKWMYUXBFX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|