C22H17N3O5S2 — CID 55517581
N-[5-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 55517581) has the molecular formula C22H17N3O5S2 and a molecular weight of 467.53 g/mol. Its IUPAC name is N-[5-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55517581 |
| Molecular Formula | C22H17N3O5S2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | N-[5-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)NCCN2C(=O)S/C(=C/c3ccccc3)C2=O)s1)c1ccco1 |
| InChI | InChI=1S/C22H17N3O5S2/c26-19(15-7-4-12-30-15)24-18-9-8-16(31-18)20(27)23-10-11-25-21(28)17(32-22(25)29)13-14-5-2-1-3-6-14/h1-9,12-13H,10-11H2,(H,23,27)(H,24,26)/b17-13+ |
| InChIKey | UZAHUSRTEARESX-GHRIWEEISA-N |
| XLogP | 4.06 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|