C20H19N3O5S — CID 30686326
N-[2-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl]-N-methylfuran-2-carboxamide (PubChem CID 30686326) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is N-[2-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl]-N-methylfuran-2-carboxamide.
| Compound Name | N-[2-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 30686326 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-[2-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl]-N-methylfuran-2-carboxamide |
| SMILES | CN(CC(=O)NCCN1C(=O)S/C(=C\c2ccccc2)C1=O)C(=O)c1ccco1 |
| InChI | InChI=1S/C20H19N3O5S/c1-22(18(25)15-8-5-11-28-15)13-17(24)21-9-10-23-19(26)16(29-20(23)27)12-14-6-3-2-4-7-14/h2-8,11-12H,9-10,13H2,1H3,(H,21,24)/b16-12- |
| InChIKey | KCJVTGUAZADHAN-VBKFSLOCSA-N |
| XLogP | 2.20 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|