C23H23N3O5S — CID 55973768
N-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-(furan-2-carbonyl)piperidine-2-carboxamide (PubChem CID 55973768) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is N-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-(furan-2-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-(furan-2-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 55973768 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-(furan-2-carbonyl)piperidine-2-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C/c2ccccc2)C1=O)C1CCCCN1C(=O)c1ccco1 |
| InChI | InChI=1S/C23H23N3O5S/c27-20(17-9-4-5-12-25(17)21(28)18-10-6-14-31-18)24-11-13-26-22(29)19(32-23(26)30)15-16-7-2-1-3-8-16/h1-3,6-8,10,14-15,17H,4-5,9,11-13H2,(H,24,27)/b19-15+ |
| InChIKey | CKPQZTNSLXBLFT-XDJHFCHBSA-N |
| XLogP | 3.13 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|