C26H27N3O3S — CID 55966453
1-(furan-2-carbonyl)-N-(3-phenothiazin-10-ylpropyl)piperidine-2-carboxamide (PubChem CID 55966453) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is 1-(furan-2-carbonyl)-N-(3-phenothiazin-10-ylpropyl)piperidine-2-carboxamide.
| Compound Name | 1-(furan-2-carbonyl)-N-(3-phenothiazin-10-ylpropyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 55966453 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 1-(furan-2-carbonyl)-N-(3-phenothiazin-10-ylpropyl)piperidine-2-carboxamide |
| SMILES | O=C(NCCCN1c2ccccc2Sc2ccccc21)C1CCCCN1C(=O)c1ccco1 |
| InChI | InChI=1S/C26H27N3O3S/c30-25(21-11-5-6-16-29(21)26(31)22-12-7-18-32-22)27-15-8-17-28-19-9-1-3-13-23(19)33-24-14-4-2-10-20(24)28/h1-4,7,9-10,12-14,18,21H,5-6,8,11,15-17H2,(H,27,30) |
| InChIKey | MLFPJCBCRZTZLQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|