C21H24N4O3 — CID 55973881
N-[3-(1H-benzimidazol-2-yl)propyl]-1-(furan-2-carbonyl)piperidine-2-carboxamide (PubChem CID 55973881) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-1-(furan-2-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-1-(furan-2-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 55973881 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-1-(furan-2-carbonyl)piperidine-2-carboxamide |
| SMILES | O=C(NCCCc1nc2ccccc2[nH]1)C1CCCCN1C(=O)c1ccco1 |
| InChI | InChI=1S/C21H24N4O3/c26-20(17-9-3-4-13-25(17)21(27)18-10-6-14-28-18)22-12-5-11-19-23-15-7-1-2-8-16(15)24-19/h1-2,6-8,10,14,17H,3-5,9,11-13H2,(H,22,26)(H,23,24) |
| InChIKey | IARLTOKVZYOJEL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|