C20H22N2O5 — CID 60552080
benzyl 2-[[1-(furan-2-carbonyl)piperidine-2-carbonyl]amino]acetate (PubChem CID 60552080) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is benzyl 2-[[1-(furan-2-carbonyl)piperidine-2-carbonyl]amino]acetate.
| Compound Name | benzyl 2-[[1-(furan-2-carbonyl)piperidine-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 60552080 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | benzyl 2-[[1-(furan-2-carbonyl)piperidine-2-carbonyl]amino]acetate |
| SMILES | O=C(CNC(=O)C1CCCCN1C(=O)c1ccco1)OCc1ccccc1 |
| InChI | InChI=1S/C20H22N2O5/c23-18(27-14-15-7-2-1-3-8-15)13-21-19(24)16-9-4-5-11-22(16)20(25)17-10-6-12-26-17/h1-3,6-8,10,12,16H,4-5,9,11,13-14H2,(H,21,24) |
| InChIKey | YZDHMOASHDDQHQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |