C19H22N2O5S — CID 166198860
N-[3-(benzenesulfonyl)propyl]-1-(furan-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 166198860) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is N-[3-(benzenesulfonyl)propyl]-1-(furan-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[3-(benzenesulfonyl)propyl]-1-(furan-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166198860 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[3-(benzenesulfonyl)propyl]-1-(furan-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCS(=O)(=O)c1ccccc1)C1CCCN1C(=O)c1ccco1 |
| InChI | InChI=1S/C19H22N2O5S/c22-18(16-9-4-12-21(16)19(23)17-10-5-13-26-17)20-11-6-14-27(24,25)15-7-2-1-3-8-15/h1-3,5,7-8,10,13,16H,4,6,9,11-12,14H2,(H,20,22) |
| InChIKey | ORCAGQPXARRGSP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|