C17H12Cl2N2O4S — CID 2672978
N-[2-[(5E)-5-[(3,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]furan-2-carboxamide (PubChem CID 2672978) has the molecular formula C17H12Cl2N2O4S and a molecular weight of 411.27 g/mol. Its IUPAC name is N-[2-[(5E)-5-[(3,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(5E)-5-[(3,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2672978 |
| Molecular Formula | C17H12Cl2N2O4S |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | N-[2-[(5E)-5-[(3,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C/c2ccc(Cl)c(Cl)c2)C1=O)c1ccco1 |
| InChI | InChI=1S/C17H12Cl2N2O4S/c18-11-4-3-10(8-12(11)19)9-14-16(23)21(17(24)26-14)6-5-20-15(22)13-2-1-7-25-13/h1-4,7-9H,5-6H2,(H,20,22)/b14-9+ |
| InChIKey | FOLRATVCIFIYAN-NTEUORMPSA-N |
| XLogP | 4.05 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|