C20H17Cl2N3O5S — CID 27565166
N-[3-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-3-oxopropyl]furan-2-carboxamide (PubChem CID 27565166) has the molecular formula C20H17Cl2N3O5S and a molecular weight of 482.35 g/mol. Its IUPAC name is N-[3-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 27565166 |
| Molecular Formula | C20H17Cl2N3O5S |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | N-[3-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-3-oxopropyl]furan-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccco1)NCCN1C(=O)S/C(=C\c2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C20H17Cl2N3O5S/c21-13-4-1-3-12(17(13)22)11-15-19(28)25(20(29)31-15)9-8-23-16(26)6-7-24-18(27)14-5-2-10-30-14/h1-5,10-11H,6-9H2,(H,23,26)(H,24,27)/b15-11- |
| InChIKey | DQJOZMADEISWIR-PTNGSMBKSA-N |
| XLogP | 3.56 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|