C19H15Cl2N3O4S — CID 24638472
N-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-oxo-1-pyridinyl)acetamide (PubChem CID 24638472) has the molecular formula C19H15Cl2N3O4S and a molecular weight of 452.32 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-oxo-1-pyridinyl)acetamide.
| Compound Name | N-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 24638472 |
| Molecular Formula | C19H15Cl2N3O4S |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | N-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2-oxo-1-pyridinyl)acetamide |
| SMILES | O=C(Cn1ccccc1=O)NCCN1C(=O)S/C(=C\c2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C19H15Cl2N3O4S/c20-13-5-3-4-12(17(13)21)10-14-18(27)24(19(28)29-14)9-7-22-15(25)11-23-8-2-1-6-16(23)26/h1-6,8,10H,7,9,11H2,(H,22,25)/b14-10- |
| InChIKey | FSZIHAZFFCRHKI-UVTDQMKNSA-N |
| XLogP | 3.01 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|