C23H22ClN3O4S — CID 17473855
3-acetamido-N-[2-[(5Z)-5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-phenylpropanamide (PubChem CID 17473855) has the molecular formula C23H22ClN3O4S and a molecular weight of 471.97 g/mol. Its IUPAC name is 3-acetamido-N-[2-[(5Z)-5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-phenylpropanamide.
| Compound Name | 3-acetamido-N-[2-[(5Z)-5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 17473855 |
| Molecular Formula | C23H22ClN3O4S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 3-acetamido-N-[2-[(5Z)-5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-phenylpropanamide |
| SMILES | CC(=O)NC(CC(=O)NCCN1C(=O)S/C(=C\c2ccccc2Cl)C1=O)c1ccccc1 |
| InChI | InChI=1S/C23H22ClN3O4S/c1-15(28)26-19(16-7-3-2-4-8-16)14-21(29)25-11-12-27-22(30)20(32-23(27)31)13-17-9-5-6-10-18(17)24/h2-10,13,19H,11-12,14H2,1H3,(H,25,29)(H,26,28)/b20-13- |
| InChIKey | AJACSAIMBDJKPT-MOSHPQCFSA-N |
| XLogP | 3.76 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|