C25H27ClN4O3S — CID 4688828
2-(4-benzylpiperazin-1-yl)-N-[2-[5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide (PubChem CID 4688828) has the molecular formula C25H27ClN4O3S and a molecular weight of 499.04 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-[2-[5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-[2-[5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 4688828 |
| Molecular Formula | C25H27ClN4O3S |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-[2-[5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
| SMILES | O=C(CN1CCN(Cc2ccccc2)CC1)NCCN1C(=O)SC(=Cc2ccccc2Cl)C1=O |
| InChI | InChI=1S/C25H27ClN4O3S/c26-21-9-5-4-8-20(21)16-22-24(32)30(25(33)34-22)11-10-27-23(31)18-29-14-12-28(13-15-29)17-19-6-2-1-3-7-19/h1-9,16H,10-15,17-18H2,(H,27,31) |
| InChIKey | ZLPFMAZRSDRGBP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|