C22H19Cl2N3O4S — CID 27565249
N-[2-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl]-2-phenylacetamide (PubChem CID 27565249) has the molecular formula C22H19Cl2N3O4S and a molecular weight of 492.38 g/mol. Its IUPAC name is N-[2-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl]-2-phenylacetamide.
| Compound Name | N-[2-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 27565249 |
| Molecular Formula | C22H19Cl2N3O4S |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | N-[2-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl]-2-phenylacetamide |
| SMILES | O=C(CNC(=O)Cc1ccccc1)NCCN1C(=O)S/C(=C\c2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C22H19Cl2N3O4S/c23-16-8-4-7-15(20(16)24)12-17-21(30)27(22(31)32-17)10-9-25-19(29)13-26-18(28)11-14-5-2-1-3-6-14/h1-8,12H,9-11,13H2,(H,25,29)(H,26,28)/b17-12- |
| InChIKey | AQMWMOQBKUAIRC-ATVHPVEESA-N |
| XLogP | 3.50 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|