C20H21ClN4O3S — CID 17481607
N-[2-[(5Z)-5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 17481607) has the molecular formula C20H21ClN4O3S and a molecular weight of 432.93 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | N-[2-[(5Z)-5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 17481607 |
| Molecular Formula | C20H21ClN4O3S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-[2-[(5Z)-5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | Cc1nn(C)c(C)c1CC(=O)NCCN1C(=O)S/C(=C\c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C20H21ClN4O3S/c1-12-15(13(2)24(3)23-12)11-18(26)22-8-9-25-19(27)17(29-20(25)28)10-14-6-4-5-7-16(14)21/h4-7,10H,8-9,11H2,1-3H3,(H,22,26)/b17-10- |
| InChIKey | CGMXWDUOJOLSHO-YVLHZVERSA-N |
| XLogP | 3.09 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|