C19H17Cl2N5O5S — CID 24536800
N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide (PubChem CID 24536800) has the molecular formula C19H17Cl2N5O5S and a molecular weight of 498.35 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 24536800 |
| Molecular Formula | C19H17Cl2N5O5S |
| Molecular Weight | 498.35 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
| SMILES | Cc1nn(CC(=O)NCCN2C(=O)S/C(=C\c3ccc(Cl)cc3Cl)C2=O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17Cl2N5O5S/c1-10-17(26(30)31)11(2)25(23-10)9-16(27)22-5-6-24-18(28)15(32-19(24)29)7-12-3-4-13(20)8-14(12)21/h3-4,7-8H,5-6,9H2,1-2H3,(H,22,27)/b15-7- |
| InChIKey | LUCZVHZHKJISEE-CHHVJCJISA-N |
| XLogP | 3.57 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|