C15H21ClN6O3 — CID 19515769
N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide (PubChem CID 19515769) has the molecular formula C15H21ClN6O3 and a molecular weight of 368.83 g/mol. Its IUPAC name is N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19515769 |
| Molecular Formula | C15H21ClN6O3 |
| Molecular Weight | 368.83 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
| SMILES | Cc1nn(CCCNC(=O)Cn2nc(C)c([N+](=O)[O-])c2C)c(C)c1Cl |
| InChI | InChI=1S/C15H21ClN6O3/c1-9-14(16)11(3)20(18-9)7-5-6-17-13(23)8-21-12(4)15(22(24)25)10(2)19-21/h5-8H2,1-4H3,(H,17,23) |
| InChIKey | QQEKCGFGGMMNEQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.83 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|