C15H20Cl2N6O3 — CID 19557958
N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide (PubChem CID 19557958) has the molecular formula C15H20Cl2N6O3 and a molecular weight of 403.27 g/mol. Its IUPAC name is N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19557958 |
| Molecular Formula | C15H20Cl2N6O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1nn(CCCNC(=O)CCn2nc(C)c([N+](=O)[O-])c2C)c(Cl)c1Cl |
| InChI | InChI=1S/C15H20Cl2N6O3/c1-9-13(16)15(17)22(19-9)7-4-6-18-12(24)5-8-21-11(3)14(23(25)26)10(2)20-21/h4-8H2,1-3H3,(H,18,24) |
| InChIKey | PAAFWEUVPJVKJY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|