C19H15Cl2N3O3S2 — CID 24536830
N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-methylsulfanylpyridine-3-carboxamide (PubChem CID 24536830) has the molecular formula C19H15Cl2N3O3S2 and a molecular weight of 468.39 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-methylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-methylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 24536830 |
| Molecular Formula | C19H15Cl2N3O3S2 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 466.99 |
| IUPAC Name | N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-methylsulfanylpyridine-3-carboxamide |
| SMILES | CSc1ncccc1C(=O)NCCN1C(=O)S/C(=C\c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C19H15Cl2N3O3S2/c1-28-17-13(3-2-6-23-17)16(25)22-7-8-24-18(26)15(29-19(24)27)9-11-4-5-12(20)10-14(11)21/h2-6,9-10H,7-8H2,1H3,(H,22,25)/b15-9- |
| InChIKey | YVCAFQIPNYEBNI-DHDCSXOGSA-N |
| XLogP | 4.58 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|