C24H22N4O4S2 — CID 39768743
N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxamide (PubChem CID 39768743) has the molecular formula C24H22N4O4S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 39768743 |
| Molecular Formula | C24H22N4O4S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxamide |
| SMILES | Cc1noc(C)c1CSc1ncccc1C(=O)NCCN1C(=O)S/C(=C\c2ccccc2)C1=O |
| InChI | InChI=1S/C24H22N4O4S2/c1-15-19(16(2)32-27-15)14-33-22-18(9-6-10-26-22)21(29)25-11-12-28-23(30)20(34-24(28)31)13-17-7-4-3-5-8-17/h3-10,13H,11-12,14H2,1-2H3,(H,25,29)/b20-13- |
| InChIKey | SPZHLAIHBYMCAF-MOSHPQCFSA-N |
| XLogP | 4.45 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|