C20H21N3O4S2 — CID 30764053
N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide (PubChem CID 30764053) has the molecular formula C20H21N3O4S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide.
| Compound Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 30764053 |
| Molecular Formula | C20H21N3O4S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide |
| SMILES | Cc1noc(C)c1CSCC(=O)NCCN1C(=O)S/C(=C\c2ccccc2)C1=O |
| InChI | InChI=1S/C20H21N3O4S2/c1-13-16(14(2)27-22-13)11-28-12-18(24)21-8-9-23-19(25)17(29-20(23)26)10-15-6-4-3-5-7-15/h3-7,10H,8-9,11-12H2,1-2H3,(H,21,24)/b17-10- |
| InChIKey | VGRMDBLRFOVVGG-YVLHZVERSA-N |
| XLogP | 3.38 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|