C18H20Cl2N2O5S2 — CID 55967303
N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-propan-2-ylsulfonylpropanamide (PubChem CID 55967303) has the molecular formula C18H20Cl2N2O5S2 and a molecular weight of 479.41 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-propan-2-ylsulfonylpropanamide.
| Compound Name | N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-propan-2-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 55967303 |
| Molecular Formula | C18H20Cl2N2O5S2 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-propan-2-ylsulfonylpropanamide |
| SMILES | CC(C)S(=O)(=O)C(C)C(=O)NCCN1C(=O)S/C(=C\c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C18H20Cl2N2O5S2/c1-10(2)29(26,27)11(3)16(23)21-6-7-22-17(24)15(28-18(22)25)8-12-4-5-13(19)9-14(12)20/h4-5,8-11H,6-7H2,1-3H3,(H,21,23)/b15-8- |
| InChIKey | WRUHSJWJQPOLRC-NVNXTCNLSA-N |
| XLogP | 3.36 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|