C17H10Cl4N2O2S — CID 6088421
(5Z)-3-[(2,5-dichloroanilino)methyl]-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 6088421) has the molecular formula C17H10Cl4N2O2S and a molecular weight of 448.16 g/mol. Its IUPAC name is (5Z)-3-[(2,5-dichloroanilino)methyl]-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(2,5-dichloroanilino)methyl]-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6088421 |
| Molecular Formula | C17H10Cl4N2O2S |
| Molecular Weight | 448.16 g/mol |
| Exact Mass | 445.92 |
| IUPAC Name | (5Z)-3-[(2,5-dichloroanilino)methyl]-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc(Cl)cc2Cl)C(=O)N1CNc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H10Cl4N2O2S/c18-10-2-1-9(13(21)6-10)5-15-16(24)23(17(25)26-15)8-22-14-7-11(19)3-4-12(14)20/h1-7,22H,8H2/b15-5- |
| InChIKey | DQPCBLMMCVQYHJ-WCSRMQSCSA-N |
| XLogP | 6.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.16 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|