C17H15Cl2N3O4S2 — CID 24536803
N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide (PubChem CID 24536803) has the molecular formula C17H15Cl2N3O4S2 and a molecular weight of 460.36 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 24536803 |
| Molecular Formula | C17H15Cl2N3O4S2 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide |
| SMILES | O=C(CN1CSCC1=O)NCCN1C(=O)S/C(=C\c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C17H15Cl2N3O4S2/c18-11-2-1-10(12(19)6-11)5-13-16(25)22(17(26)28-13)4-3-20-14(23)7-21-9-27-8-15(21)24/h1-2,5-6H,3-4,7-9H2,(H,20,23)/b13-5- |
| InChIKey | VTHYOFPEMCNKBZ-ACAGNQJTSA-N |
| XLogP | 2.68 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|