C20H23N3O7S2 — CID 24680517
N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide (PubChem CID 24680517) has the molecular formula C20H23N3O7S2 and a molecular weight of 481.55 g/mol. Its IUPAC name is N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 24680517 |
| Molecular Formula | C20H23N3O7S2 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide |
| SMILES | COc1cc(/C=C2\SC(=O)N(CCNC(=O)CN3CSCC3=O)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H23N3O7S2/c1-28-13-6-12(7-14(29-2)18(13)30-3)8-15-19(26)23(20(27)32-15)5-4-21-16(24)9-22-11-31-10-17(22)25/h6-8H,4-5,9-11H2,1-3H3,(H,21,24)/b15-8- |
| InChIKey | CIFYQKCFZNLJOA-NVNXTCNLSA-N |
| XLogP | 1.40 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|