C20H23F3N2O7S — CID 43078187
N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 43078187) has the molecular formula C20H23F3N2O7S and a molecular weight of 492.47 g/mol. Its IUPAC name is N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 43078187 |
| Molecular Formula | C20H23F3N2O7S |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | COc1cc(/C=C2\SC(=O)N(CCNC(=O)C(C)OCC(F)(F)F)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H23F3N2O7S/c1-11(32-10-20(21,22)23)17(26)24-5-6-25-18(27)15(33-19(25)28)9-12-7-13(29-2)16(31-4)14(8-12)30-3/h7-9,11H,5-6,10H2,1-4H3,(H,24,26)/b15-9- |
| InChIKey | ZKVFVSQGRFZIJI-DHDCSXOGSA-N |
| XLogP | 2.83 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|