C23H24N2O6S2 — CID 3895936
N-[2-[2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-phenylsulfanylacetamide (PubChem CID 3895936) has the molecular formula C23H24N2O6S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-[2-[2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[2-[2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 3895936 |
| Molecular Formula | C23H24N2O6S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | N-[2-[2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-phenylsulfanylacetamide |
| SMILES | COc1cc(C=C2SC(=O)N(CCNC(=O)CSc3ccccc3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C23H24N2O6S2/c1-29-17-11-15(12-18(30-2)21(17)31-3)13-19-22(27)25(23(28)33-19)10-9-24-20(26)14-32-16-7-5-4-6-8-16/h4-8,11-13H,9-10,14H2,1-3H3,(H,24,26) |
| InChIKey | SPCYQIPUSUPPGO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|