C19H20N4O6S3 — CID 55821993
N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide (PubChem CID 55821993) has the molecular formula C19H20N4O6S3 and a molecular weight of 496.59 g/mol. Its IUPAC name is N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide.
| Compound Name | N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 55821993 |
| Molecular Formula | C19H20N4O6S3 |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
| SMILES | COc1cc(/C=C2\SC(=O)N(CCNC(=O)CSc3nncs3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N4O6S3/c1-27-12-6-11(7-13(28-2)16(12)29-3)8-14-17(25)23(19(26)32-14)5-4-20-15(24)9-30-18-22-21-10-31-18/h6-8,10H,4-5,9H2,1-3H3,(H,20,24)/b14-8- |
| InChIKey | CDOOGXDQLLHMML-ZSOIEALJSA-N |
| XLogP | 2.51 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|