C21H20ClN3O6S — CID 92968404
6-chloro-N-[2-[(5E)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]pyridine-3-carboxamide (PubChem CID 92968404) has the molecular formula C21H20ClN3O6S and a molecular weight of 477.93 g/mol. Its IUPAC name is 6-chloro-N-[2-[(5E)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[2-[(5E)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 92968404 |
| Molecular Formula | C21H20ClN3O6S |
| Molecular Weight | 477.93 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 6-chloro-N-[2-[(5E)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]pyridine-3-carboxamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CCNC(=O)c3ccc(Cl)nc3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H20ClN3O6S/c1-29-14-8-12(9-15(30-2)18(14)31-3)10-16-20(27)25(21(28)32-16)7-6-23-19(26)13-4-5-17(22)24-11-13/h4-5,8-11H,6-7H2,1-3H3,(H,23,26)/b16-10+ |
| InChIKey | AVIAMKBCRDQKDQ-MHWRWJLKSA-N |
| XLogP | 3.23 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.93 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|