C19H14ClF2N3O4S — CID 27512930
6-chloro-N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]pyridine-3-carboxamide (PubChem CID 27512930) has the molecular formula C19H14ClF2N3O4S and a molecular weight of 453.85 g/mol. Its IUPAC name is 6-chloro-N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 27512930 |
| Molecular Formula | C19H14ClF2N3O4S |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 6-chloro-N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccc(OC(F)F)cc2)C1=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H14ClF2N3O4S/c20-15-6-3-12(10-24-15)16(26)23-7-8-25-17(27)14(30-19(25)28)9-11-1-4-13(5-2-11)29-18(21)22/h1-6,9-10,18H,7-8H2,(H,23,26)/b14-9- |
| InChIKey | HQTDUUUPNBTOPP-ZROIWOOFSA-N |
| XLogP | 3.80 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|