C19H16F2N4O5S — CID 4279625
N-[2-[5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 4279625) has the molecular formula C19H16F2N4O5S and a molecular weight of 450.42 g/mol. Its IUPAC name is N-[2-[5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[2-[5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 4279625 |
| Molecular Formula | C19H16F2N4O5S |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | N-[2-[5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCCN2C(=O)SC(=Cc3ccc(OC(F)F)cc3)C2=O)ccc1=O |
| InChI | InChI=1S/C19H16F2N4O5S/c1-24-15(26)7-6-13(23-24)16(27)22-8-9-25-17(28)14(31-19(25)29)10-11-2-4-12(5-3-11)30-18(20)21/h2-7,10,18H,8-9H2,1H3,(H,22,27) |
| InChIKey | TWCXFWYCKVGMJK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|