C18H14F2N4O4S — CID 2471183
N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]pyrazine-2-carboxamide (PubChem CID 2471183) has the molecular formula C18H14F2N4O4S and a molecular weight of 420.40 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 2471183 |
| Molecular Formula | C18H14F2N4O4S |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccc(OC(F)F)cc2)C1=O)c1cnccn1 |
| InChI | InChI=1S/C18H14F2N4O4S/c19-17(20)28-12-3-1-11(2-4-12)9-14-16(26)24(18(27)29-14)8-7-23-15(25)13-10-21-5-6-22-13/h1-6,9-10,17H,7-8H2,(H,23,25)/b14-9- |
| InChIKey | VRTCQXKYQKJIHG-ZROIWOOFSA-N |
| XLogP | 2.54 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|