C17H18F2N2O4S — CID 17479739
N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]butanamide (PubChem CID 17479739) has the molecular formula C17H18F2N2O4S and a molecular weight of 384.40 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]butanamide.
| Compound Name | N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 17479739 |
| Molecular Formula | C17H18F2N2O4S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]butanamide |
| SMILES | CCCC(=O)NCCN1C(=O)S/C(=C\c2ccc(OC(F)F)cc2)C1=O |
| InChI | InChI=1S/C17H18F2N2O4S/c1-2-3-14(22)20-8-9-21-15(23)13(26-17(21)24)10-11-4-6-12(7-5-11)25-16(18)19/h4-7,10,16H,2-3,8-9H2,1H3,(H,20,22)/b13-10- |
| InChIKey | UMPYTGCGAKUOBB-RAXLEYEMSA-N |
| XLogP | 3.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|