C19H15F2N3O4S2 — CID 43054188
N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 43054188) has the molecular formula C19H15F2N3O4S2 and a molecular weight of 451.48 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43054188 |
| Molecular Formula | C19H15F2N3O4S2 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccc(OC(F)F)cc2)C1=O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C19H15F2N3O4S2/c20-18(21)28-12-5-3-11(4-6-12)10-14-17(26)24(19(27)30-14)9-8-22-15(25)13-2-1-7-23-16(13)29/h1-7,10,18H,8-9H2,(H,22,25)(H,23,29)/b14-10- |
| InChIKey | MXPWCWWCUZJXNZ-UVTDQMKNSA-N |
| XLogP | 3.81 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|