C23H19F2N3O5S — CID 55339626
2-(4-cyanophenoxy)-N-[2-[(5E)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]propanamide (PubChem CID 55339626) has the molecular formula C23H19F2N3O5S and a molecular weight of 487.48 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-[2-[(5E)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]propanamide.
| Compound Name | 2-(4-cyanophenoxy)-N-[2-[(5E)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 55339626 |
| Molecular Formula | C23H19F2N3O5S |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-[2-[(5E)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]propanamide |
| SMILES | CC(Oc1ccc(C#N)cc1)C(=O)NCCN1C(=O)S/C(=C/c2ccc(OC(F)F)cc2)C1=O |
| InChI | InChI=1S/C23H19F2N3O5S/c1-14(32-17-8-4-16(13-26)5-9-17)20(29)27-10-11-28-21(30)19(34-23(28)31)12-15-2-6-18(7-3-15)33-22(24)25/h2-9,12,14,22H,10-11H2,1H3,(H,27,29)/b19-12+ |
| InChIKey | QQWRKVXXGRKUHI-XDHOZWIPSA-N |
| XLogP | 3.78 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|