C19H22F2N4O5S2 — CID 55339477
2-(carbamoylamino)-N-[2-[(5E)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylsulfanylbutanamide (PubChem CID 55339477) has the molecular formula C19H22F2N4O5S2 and a molecular weight of 488.54 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-[2-[(5E)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylsulfanylbutanamide.
| Compound Name | 2-(carbamoylamino)-N-[2-[(5E)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 55339477 |
| Molecular Formula | C19H22F2N4O5S2 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 2-(carbamoylamino)-N-[2-[(5E)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NC(N)=O)C(=O)NCCN1C(=O)S/C(=C/c2ccc(OC(F)F)cc2)C1=O |
| InChI | InChI=1S/C19H22F2N4O5S2/c1-31-9-6-13(24-18(22)28)15(26)23-7-8-25-16(27)14(32-19(25)29)10-11-2-4-12(5-3-11)30-17(20)21/h2-5,10,13,17H,6-9H2,1H3,(H,23,26)(H3,22,24,28)/b14-10+ |
| InChIKey | PHSBQKJBJCOSRI-GXDHUFHOSA-N |
| XLogP | 2.23 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|