C22H20F2N6O6S — CID 16620541
N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide (PubChem CID 16620541) has the molecular formula C22H20F2N6O6S and a molecular weight of 534.50 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide.
| Compound Name | N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
|---|---|
| PubChem CID | 16620541 |
| Molecular Formula | C22H20F2N6O6S |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | N-[2-[(5Z)-5-[[4-(difluoromethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)NCCN2C(=O)S/C(=C\c3ccc(OC(F)F)cc3)C2=O)n(C)c1=O |
| InChI | InChI=1S/C22H20F2N6O6S/c1-27-17-16(19(33)28(2)21(27)34)29(11-26-17)10-15(31)25-7-8-30-18(32)14(37-22(30)35)9-12-3-5-13(6-4-12)36-20(23)24/h3-6,9,11,20H,7-8,10H2,1-2H3,(H,25,31)/b14-9- |
| InChIKey | VYFAZSYZGRHNIQ-ZROIWOOFSA-N |
| XLogP | 0.89 |
| TPSA | 137.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|