C16H16N6O4S — CID 2459755
N-[2-[(5E)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(tetrazol-1-yl)acetamide (PubChem CID 2459755) has the molecular formula C16H16N6O4S and a molecular weight of 388.41 g/mol. Its IUPAC name is N-[2-[(5E)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-[2-[(5E)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 2459755 |
| Molecular Formula | C16H16N6O4S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[2-[(5E)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(tetrazol-1-yl)acetamide |
| SMILES | COc1ccc(/C=C2/SC(=O)N(CCNC(=O)Cn3cnnn3)C2=O)cc1 |
| InChI | InChI=1S/C16H16N6O4S/c1-26-12-4-2-11(3-5-12)8-13-15(24)22(16(25)27-13)7-6-17-14(23)9-21-10-18-19-20-21/h2-5,8,10H,6-7,9H2,1H3,(H,17,23)/b13-8+ |
| InChIKey | DVRKSCMBYKLPBJ-MDWZMJQESA-N |
| XLogP | 0.53 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|