C24H24ClN3O4S2 — CID 3569403
N-[1-[2-[5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 3569403) has the molecular formula C24H24ClN3O4S2 and a molecular weight of 518.06 g/mol. Its IUPAC name is N-[1-[2-[5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[1-[2-[5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 3569403 |
| Molecular Formula | C24H24ClN3O4S2 |
| Molecular Weight | 518.06 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | N-[1-[2-[5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CSCCC(NC(=O)c1ccccc1)C(=O)NCCN1C(=O)SC(=Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C24H24ClN3O4S2/c1-33-14-11-19(27-21(29)17-5-3-2-4-6-17)22(30)26-12-13-28-23(31)20(34-24(28)32)15-16-7-9-18(25)10-8-16/h2-10,15,19H,11-14H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | FWXLHDCKRJMUMJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.06 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|