C21H19F2N3O6S — CID 24547127
N-[2-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-methoxypyridine-3-carboxamide (PubChem CID 24547127) has the molecular formula C21H19F2N3O6S and a molecular weight of 479.46 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-methoxypyridine-3-carboxamide.
| Compound Name | N-[2-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 24547127 |
| Molecular Formula | C21H19F2N3O6S |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | N-[2-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-methoxypyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)NCCN2C(=O)S/C(=C\c3ccc(OC(F)F)c(OC)c3)C2=O)cn1 |
| InChI | InChI=1S/C21H19F2N3O6S/c1-30-15-9-12(3-5-14(15)32-20(22)23)10-16-19(28)26(21(29)33-16)8-7-24-18(27)13-4-6-17(31-2)25-11-13/h3-6,9-11,20H,7-8H2,1-2H3,(H,24,27)/b16-10- |
| InChIKey | MKTFRLOIXGTGCN-YBEGLDIGSA-N |
| XLogP | 3.17 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|