C23H22F2N2O6S — CID 24547122
N-[2-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(methoxymethyl)benzamide (PubChem CID 24547122) has the molecular formula C23H22F2N2O6S and a molecular weight of 492.50 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(methoxymethyl)benzamide.
| Compound Name | N-[2-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(methoxymethyl)benzamide |
|---|---|
| PubChem CID | 24547122 |
| Molecular Formula | C23H22F2N2O6S |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | N-[2-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(methoxymethyl)benzamide |
| SMILES | COCc1cccc(C(=O)NCCN2C(=O)S/C(=C\c3ccc(OC(F)F)c(OC)c3)C2=O)c1 |
| InChI | InChI=1S/C23H22F2N2O6S/c1-31-13-15-4-3-5-16(10-15)20(28)26-8-9-27-21(29)19(34-23(27)30)12-14-6-7-17(33-22(24)25)18(11-14)32-2/h3-7,10-12,22H,8-9,13H2,1-2H3,(H,26,28)/b19-12- |
| InChIKey | QJTBAGMEDNWGRO-UNOMPAQXSA-N |
| XLogP | 3.91 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|