C21H26F2N2O6S — CID 39391365
N-[2-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(2-methylpropoxy)propanamide (PubChem CID 39391365) has the molecular formula C21H26F2N2O6S and a molecular weight of 472.51 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(2-methylpropoxy)propanamide.
| Compound Name | N-[2-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(2-methylpropoxy)propanamide |
|---|---|
| PubChem CID | 39391365 |
| Molecular Formula | C21H26F2N2O6S |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | N-[2-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(2-methylpropoxy)propanamide |
| SMILES | COc1cc(/C=C2\SC(=O)N(CCNC(=O)CCOCC(C)C)C2=O)ccc1OC(F)F |
| InChI | InChI=1S/C21H26F2N2O6S/c1-13(2)12-30-9-6-18(26)24-7-8-25-19(27)17(32-21(25)28)11-14-4-5-15(31-20(22)23)16(10-14)29-3/h4-5,10-11,13,20H,6-9,12H2,1-3H3,(H,24,26)/b17-11- |
| InChIKey | AXLTXUOEOACKPR-BOPFTXTBSA-N |
| XLogP | 3.51 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|