C25H26N2O5S — CID 52651946
N-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-cyclopentyloxy-3-methoxybenzamide (PubChem CID 52651946) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is N-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-cyclopentyloxy-3-methoxybenzamide.
| Compound Name | N-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-cyclopentyloxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 52651946 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-cyclopentyloxy-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCCN2C(=O)S/C(=C/c3ccccc3)C2=O)ccc1OC1CCCC1 |
| InChI | InChI=1S/C25H26N2O5S/c1-31-21-16-18(11-12-20(21)32-19-9-5-6-10-19)23(28)26-13-14-27-24(29)22(33-25(27)30)15-17-7-3-2-4-8-17/h2-4,7-8,11-12,15-16,19H,5-6,9-10,13-14H2,1H3,(H,26,28)/b22-15+ |
| InChIKey | SLNCBYZZMIXUNX-PXLXIMEGSA-N |
| XLogP | 4.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|