C26H25N3O3S — CID 2479992
(6S)-N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 2479992) has the molecular formula C26H25N3O3S and a molecular weight of 459.57 g/mol. Its IUPAC name is (6S)-N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | (6S)-N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 2479992 |
| Molecular Formula | C26H25N3O3S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (6S)-N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | C[C@H]1CCc2[nH]c3ccc(C(=O)NCCN4C(=O)S/C(=C\c5ccccc5)C4=O)cc3c2C1 |
| InChI | InChI=1S/C26H25N3O3S/c1-16-7-9-21-19(13-16)20-15-18(8-10-22(20)28-21)24(30)27-11-12-29-25(31)23(33-26(29)32)14-17-5-3-2-4-6-17/h2-6,8,10,14-16,28H,7,9,11-13H2,1H3,(H,27,30)/b23-14-/t16-/m0/s1 |
| InChIKey | ZJPXSVKAKCVHJI-ZGWJWYQGSA-N |
| XLogP | 4.76 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|