C24H25N3O — CID 2114335
(6S)-N-[2-(1H-indol-3-yl)ethyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 2114335) has the molecular formula C24H25N3O and a molecular weight of 371.48 g/mol. Its IUPAC name is (6S)-N-[2-(1H-indol-3-yl)ethyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | (6S)-N-[2-(1H-indol-3-yl)ethyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 2114335 |
| Molecular Formula | C24H25N3O |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | (6S)-N-[2-(1H-indol-3-yl)ethyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | C[C@H]1CCc2[nH]c3ccc(C(=O)NCCc4c[nH]c5ccccc45)cc3c2C1 |
| InChI | InChI=1S/C24H25N3O/c1-15-6-8-22-19(12-15)20-13-16(7-9-23(20)27-22)24(28)25-11-10-17-14-26-21-5-3-2-4-18(17)21/h2-5,7,9,13-15,26-27H,6,8,10-12H2,1H3,(H,25,28)/t15-/m0/s1 |
| InChIKey | BUUWWGUPPHIBHG-HNNXBMFYSA-N |
| XLogP | 4.75 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|