C24H29N3O — CID 26447575
(6S)-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 26447575) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is (6S)-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | (6S)-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 26447575 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (6S)-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | C[C@H]1CCc2[nH]c3ccc(C(=O)NCc4ccc(CN(C)C)cc4)cc3c2C1 |
| InChI | InChI=1S/C24H29N3O/c1-16-4-10-22-20(12-16)21-13-19(9-11-23(21)26-22)24(28)25-14-17-5-7-18(8-6-17)15-27(2)3/h5-9,11,13,16,26H,4,10,12,14-15H2,1-3H3,(H,25,28)/t16-/m0/s1 |
| InChIKey | AQNWSKIYNIHNHF-INIZCTEOSA-N |
| XLogP | 4.28 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|