C23H24N2O3 — CID 42941245
methyl 2-[4-[(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]phenyl]acetate (PubChem CID 42941245) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is methyl 2-[4-[(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]phenyl]acetate.
| Compound Name | methyl 2-[4-[(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 42941245 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | methyl 2-[4-[(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(NC(=O)c2ccc3[nH]c4c(c3c2)CC(C)CC4)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-14-3-9-20-18(11-14)19-13-16(6-10-21(19)25-20)23(27)24-17-7-4-15(5-8-17)12-22(26)28-2/h4-8,10,13-14,25H,3,9,11-12H2,1-2H3,(H,24,27) |
| InChIKey | RQMTYLSMFSXQPO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|